Products 1039894-09-1
CAS 1039894-09-1 is the registry number for (4-(2,3-Dichlorophenoxy)phenyl)methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[4-(2,3-dichlorophenoxy)phenyl]methanamine (CAS 1039894-09-1) is a chemical compound with the molecular formula C13H11Cl2NO and a molecular weight of 268.13 g/mol. IUPAC name: [4-(2,3-dichlorophenoxy)phenyl]methanamine. InChIKey: HWHMEGUWURTJBZ-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO |
|---|---|
| Molecular weight | 268.13 g/mol |
| IUPAC name | [4-(2,3-dichlorophenoxy)phenyl]methanamine |
| InChIKey | HWHMEGUWURTJBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)OC2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)