Products 1513190-87-8
CAS 1513190-87-8 appears in our catalog under these names: 2-(Benzyloxy)-4,5-dichloroaniline 95%, 2-(benzyloxy)-4,5-dichloroaniline, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,5-dichloro-2-phenylmethoxyaniline (CAS 1513190-87-8) is a chemical compound with the molecular formula C13H11Cl2NO and a molecular weight of 268.13 g/mol. IUPAC name: 4,5-dichloro-2-phenylmethoxyaniline. InChIKey: WFWWJTGETSTQMY-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO |
|---|---|
| Molecular weight | 268.13 g/mol |
| IUPAC name | 4,5-dichloro-2-phenylmethoxyaniline |
| InChIKey | WFWWJTGETSTQMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2N)Cl)Cl |
Computed by PubChem (NCBI)