Products 58597-08-3
CAS 58597-08-3 is the registry number for 2,6-Dichloro-3-(4-methoxybenzyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
2,6-dichloro-3-[(4-methoxyphenyl)methyl]pyridine (CAS 58597-08-3) is a chemical compound with the molecular formula C13H11Cl2NO and a molecular weight of 268.13 g/mol. IUPAC name: 2,6-dichloro-3-[(4-methoxyphenyl)methyl]pyridine. InChIKey: WMBKYACYZZXVCI-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO |
|---|---|
| Molecular weight | 268.13 g/mol |
| IUPAC name | 2,6-dichloro-3-[(4-methoxyphenyl)methyl]pyridine |
| InChIKey | WMBKYACYZZXVCI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CC2=C(N=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)