CAS 428822-93-9 is the registry number for 1-(2,3-Dichloro-phenyl)-2,5-dimethyl-1h-pyrrole-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde (CAS 428822-93-9) is a chemical compound with the molecular formula C13H11Cl2NO and a molecular weight of 268.13 g/mol. IUPAC name: 1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde. InChIKey: USZNZBLCWAILCR-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO |
|---|---|
| Molecular weight | 268.13 g/mol |
| IUPAC name | 1-(2,3-dichlorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| InChIKey | USZNZBLCWAILCR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=C(C(=CC=C2)Cl)Cl)C)C=O |
Computed by PubChem (NCBI)