CAS 1007346-28-2 appears in our catalog under these names: 4'–Bromo–2',3'–difluoroacetophenone, 4'-Bromo-2',3'-difluoroacetophenone 95%, 4'-BROMO-2',3'-DIFLUOROACETOPHENONE, 98%, 4'-Bromo-2',3'-difluoroacetophenone, 95%, 95%, 1-(2,3-Difluoro-4-bromophenyl)ethanone. Offered by: GLPBio, Ambeed, Fluorochem, Chemat, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 2,5g.
1-(4-bromo-2,3-difluorophenyl)ethanone (CAS 1007346-28-2) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 1-(4-bromo-2,3-difluorophenyl)ethanone. InChIKey: HOVLHMHPYDXOKE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 1-(4-bromo-2,3-difluorophenyl)ethanone |
| InChIKey | HOVLHMHPYDXOKE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)Br)F)F |
Computed by PubChem (NCBI)