CAS 1007386-45-9 is the registry number for 3-Bromo-6h-thieno(2,3-b)pyrrole-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid (CAS 1007386-45-9) is a chemical compound with the molecular formula C7H4BrNO2S and a molecular weight of 246.08 g/mol. IUPAC name: 3-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid. InChIKey: BFQKWXMSMYDJQT-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO2S |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 3-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid |
| InChIKey | BFQKWXMSMYDJQT-UHFFFAOYSA-N |
| SMILES | C1=C(NC2=C1C(=CS2)Br)C(=O)O |
Computed by PubChem (NCBI)