CAS 2476729-56-1 is the registry number for 3-Bromothieno[3,2-b]pyridine-5,7(4H,6H)-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-4H-thieno[3,2-b]pyridine-5,7-dione (CAS 2476729-56-1) is a chemical compound with the molecular formula C7H4BrNO2S and a molecular weight of 246.08 g/mol. IUPAC name: 3-bromo-4H-thieno[3,2-b]pyridine-5,7-dione. InChIKey: SJCPJTWQCXSRMF-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO2S |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 3-bromo-4H-thieno[3,2-b]pyridine-5,7-dione |
| InChIKey | SJCPJTWQCXSRMF-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(C(=CS2)Br)NC1=O |
Computed by PubChem (NCBI)