CAS 1427080-37-2 appears in our catalog under these names: 6-Bromobenzo(d)isothiazol-3(2H)-one 1-oxide, 95%, 6-Bromobenzo(D)isothiazol-3(2H)-one 1-oxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-bromo-1-oxo-1,2-benzothiazol-3-one (CAS 1427080-37-2) is a chemical compound with the molecular formula C7H4BrNO2S and a molecular weight of 246.08 g/mol. IUPAC name: 6-bromo-1-oxo-1,2-benzothiazol-3-one. InChIKey: KWKIZTMNUKDXAL-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO2S |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 6-bromo-1-oxo-1,2-benzothiazol-3-one |
| InChIKey | KWKIZTMNUKDXAL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)S(=O)NC2=O |
Computed by PubChem (NCBI)