Products 332098-83-6

CAS 332098-83-6 is the registry number for 2-Bromo-6H-thieno(2,3-b)pyrrole-5-carboxylic Acid. Offered by: TRC, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid (CAS 332098-83-6) is a chemical compound with the molecular formula C7H4BrNO2S and a molecular weight of 246.08 g/mol. IUPAC name: 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid. InChIKey: XAFRVVYPVBHBMA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BrNO2S
Molecular weight246.08 g/mol
IUPAC name2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid
InChIKeyXAFRVVYPVBHBMA-UHFFFAOYSA-N
SMILESC1=C(NC2=C1C=C(S2)Br)C(=O)O

Computed by PubChem (NCBI)