CAS 332098-83-6 is the registry number for 2-Bromo-6H-thieno(2,3-b)pyrrole-5-carboxylic Acid. Offered by: TRC, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid (CAS 332098-83-6) is a chemical compound with the molecular formula C7H4BrNO2S and a molecular weight of 246.08 g/mol. IUPAC name: 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid. InChIKey: XAFRVVYPVBHBMA-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO2S |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid |
| InChIKey | XAFRVVYPVBHBMA-UHFFFAOYSA-N |
| SMILES | C1=C(NC2=C1C=C(S2)Br)C(=O)O |
Computed by PubChem (NCBI)