Products 1007387-00-9

CAS 1007387-00-9 is the registry number for 4-Bromo-6h-thieno[2,3-b]pyrrole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid (CAS 1007387-00-9) is a chemical compound with the molecular formula C7H4BrNO2S and a molecular weight of 246.08 g/mol. IUPAC name: 4-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid. InChIKey: OONJRWDQJMBPMF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BrNO2S
Molecular weight246.08 g/mol
IUPAC name4-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid
InChIKeyOONJRWDQJMBPMF-UHFFFAOYSA-N
SMILESC1=CSC2=C1C(=C(N2)C(=O)O)Br

Computed by PubChem (NCBI)