CAS 1007387-00-9 is the registry number for 4-Bromo-6h-thieno[2,3-b]pyrrole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid (CAS 1007387-00-9) is a chemical compound with the molecular formula C7H4BrNO2S and a molecular weight of 246.08 g/mol. IUPAC name: 4-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid. InChIKey: OONJRWDQJMBPMF-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO2S |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 4-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid |
| InChIKey | OONJRWDQJMBPMF-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=C(N2)C(=O)O)Br |
Computed by PubChem (NCBI)