CAS 332099-36-2 appears in our catalog under these names: 3-Bromo-4h-thieno[3,2-b]pyrrole-5-carboxylic acid, 97%, 3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g.
3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (CAS 332099-36-2) is a chemical compound with the molecular formula C7H4BrNO2S and a molecular weight of 246.08 g/mol. IUPAC name: 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid. InChIKey: WQGQGYADKDKACG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO2S |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | WQGQGYADKDKACG-UHFFFAOYSA-N |
| SMILES | C1=C(NC2=C1SC=C2Br)C(=O)O |
Computed by PubChem (NCBI)