CAS 1007388-09-1 is the registry number for Methyl 6-bromo-4h-furo[3,2-b]pyrrole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate (CAS 1007388-09-1) is a chemical compound with the molecular formula C8H6BrNO2S and a molecular weight of 260.11 g/mol. IUPAC name: methyl 6-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate. InChIKey: KTXFTHROEROVGD-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2S |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | methyl 6-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate |
| InChIKey | KTXFTHROEROVGD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(N1)C=CS2)Br |
Computed by PubChem (NCBI)