CAS 859969-64-5 is the registry number for 5-Amino-3-bromobenzo[b]thiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-1,1-dioxo-1-benzothiophen-5-amine (CAS 859969-64-5) is a chemical compound with the molecular formula C8H6BrNO2S and a molecular weight of 260.11 g/mol. IUPAC name: 3-bromo-1,1-dioxo-1-benzothiophen-5-amine. InChIKey: DERAROPMTGMQPK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2S |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | 3-bromo-1,1-dioxo-1-benzothiophen-5-amine |
| InChIKey | DERAROPMTGMQPK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=CS2(=O)=O)Br |
Computed by PubChem (NCBI)