CAS 126891-45-0 appears in our catalog under these names: 4-Bromobenzenesulfonyl acetonitrile, 95%, 4-Bromobenzenesulphonylacetonitrile, 4-Bromobenzenesulfonylacetonitrile. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 100g, 250g.
2-(4-bromophenyl)sulfonylacetonitrile (CAS 126891-45-0) is a chemical compound with the molecular formula C8H6BrNO2S and a molecular weight of 260.11 g/mol. IUPAC name: 2-(4-bromophenyl)sulfonylacetonitrile. InChIKey: KSKSEVVFIOHIAT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2S |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | 2-(4-bromophenyl)sulfonylacetonitrile |
| InChIKey | KSKSEVVFIOHIAT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)CC#N)Br |
Computed by PubChem (NCBI)