Products 62054-43-7

CAS 62054-43-7 is the registry number for 3-​(Bromomethyl)​-1,​2-​benzisothiazol 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(bromomethyl)-1,2-benzothiazole 1,1-dioxide (CAS 62054-43-7) is a chemical compound with the molecular formula C8H6BrNO2S and a molecular weight of 260.11 g/mol. IUPAC name: 3-(bromomethyl)-1,2-benzothiazole 1,1-dioxide. InChIKey: VOFHJUGBYKSCFK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrNO2S
Molecular weight260.11 g/mol
IUPAC name3-(bromomethyl)-1,2-benzothiazole 1,1-dioxide
InChIKeyVOFHJUGBYKSCFK-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=NS2(=O)=O)CBr

Computed by PubChem (NCBI)