CAS 62054-43-7 is the registry number for 3-​(Bromomethyl)​-1,​2-​benzisothiazol 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(bromomethyl)-1,2-benzothiazole 1,1-dioxide (CAS 62054-43-7) is a chemical compound with the molecular formula C8H6BrNO2S and a molecular weight of 260.11 g/mol. IUPAC name: 3-(bromomethyl)-1,2-benzothiazole 1,1-dioxide. InChIKey: VOFHJUGBYKSCFK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2S |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | 3-(bromomethyl)-1,2-benzothiazole 1,1-dioxide |
| InChIKey | VOFHJUGBYKSCFK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NS2(=O)=O)CBr |
Computed by PubChem (NCBI)