CAS 1094268-93-5 is the registry number for 6-Bromo-7-sulfanyl-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-bromo-7-sulfanyl-4H-1,4-benzoxazin-3-one (CAS 1094268-93-5) is a chemical compound with the molecular formula C8H6BrNO2S and a molecular weight of 260.11 g/mol. IUPAC name: 6-bromo-7-sulfanyl-4H-1,4-benzoxazin-3-one. InChIKey: HGOOUVFEJOMPTH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2S |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | 6-bromo-7-sulfanyl-4H-1,4-benzoxazin-3-one |
| InChIKey | HGOOUVFEJOMPTH-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=C(C=C2O1)S)Br |
Computed by PubChem (NCBI)