CAS 1381776-46-0 is the registry number for 3-Bromo-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (CAS 1381776-46-0) is a chemical compound with the molecular formula C8H6BrNO2S and a molecular weight of 260.11 g/mol. IUPAC name: 3-bromo-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid. InChIKey: AIKGKRKSYRMDMT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2S |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | 3-bromo-6-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | AIKGKRKSYRMDMT-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1SC=C2Br)C(=O)O |
Computed by PubChem (NCBI)