Products 1007455-21-1
CAS 1007455-21-1 appears in our catalog under these names: 2-Bromo-4-fluoro-5-methoxybenzoic acid, 98%, 98%, 2-BROMO-4-FLUORO-5-METHOXYBENZOIC ACID, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
2-bromo-4-fluoro-5-methoxybenzoic acid (CAS 1007455-21-1) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 2-bromo-4-fluoro-5-methoxybenzoic acid. InChIKey: HECJSMILDFGZPA-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 2-bromo-4-fluoro-5-methoxybenzoic acid |
| InChIKey | HECJSMILDFGZPA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)Br)F |
Computed by PubChem (NCBI)