CAS 1007877-71-5 appears in our catalog under these names: (R)-A-(Dimethylamino)benzeneacetic acid hydrochloride, 96%, (R)-2-(Dimethylamino)-2-phenylacetic acid hydrochloride, 95%, (2R)-2-(Dimethylamino)-2-phenylacetic acid hydrochloride, (R)-2-(Dimethylamino)-2-phenylacetic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g, 500mg.
(2R)-2-(dimethylamino)-2-phenylacetic acid;hydrochloride (CAS 1007877-71-5) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (2R)-2-(dimethylamino)-2-phenylacetic acid;hydrochloride. InChIKey: FQYXFGONKKDOKW-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (2R)-2-(dimethylamino)-2-phenylacetic acid;hydrochloride |
| InChIKey | FQYXFGONKKDOKW-SBSPUUFOSA-N |
| SMILES | CN(C)[C@H](C1=CC=CC=C1)C(=O)O.Cl |
Computed by PubChem (NCBI)