CAS 1008068-90-3 appears in our catalog under these names: 5-[2-(Methylsulfonyl)ethyl]imidazolidine-2,4-dione, 95%, 5-(2-Methanesulfonylethyl)imidazolidine-2,4-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-(2-methylsulfonylethyl)imidazolidine-2,4-dione (CAS 1008068-90-3) is a chemical compound with the molecular formula C6H10N2O4S and a molecular weight of 206.22 g/mol. IUPAC name: 5-(2-methylsulfonylethyl)imidazolidine-2,4-dione. InChIKey: ZJPWDHCJZZYZNS-UHFFFAOYSA-N.
| Molecular formula | C6H10N2O4S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 5-(2-methylsulfonylethyl)imidazolidine-2,4-dione |
| InChIKey | ZJPWDHCJZZYZNS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CCC1C(=O)NC(=O)N1 |
Computed by PubChem (NCBI)