CAS 16245-77-5 is the registry number for 1,4-Phenylenediamine Sulfate, >98.0%(T). Offered by: TCI. Available pack sizes: 25g, 500g.
Benzene-1,4-diamine;sulfuric acid (CAS 16245-77-5) is a chemical compound with the molecular formula C6H10N2O4S and a molecular weight of 206.22 g/mol. IUPAC name: benzene-1,4-diamine;sulfuric acid. InChIKey: UFPKLWVNKAMAPE-UHFFFAOYSA-N.
| Molecular formula | C6H10N2O4S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | benzene-1,4-diamine;sulfuric acid |
| InChIKey | UFPKLWVNKAMAPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)