CAS 2228135-07-5 is the registry number for 4H,5H,6H-Pyrrolo(3,4-c)(1,2)oxazole, methanesulfonic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole;methanesulfonic acid (CAS 2228135-07-5) is a chemical compound with the molecular formula C6H10N2O4S and a molecular weight of 206.22 g/mol. IUPAC name: 5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole;methanesulfonic acid. InChIKey: VSOYKBVTGHGMKC-UHFFFAOYSA-N.
| Molecular formula | C6H10N2O4S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole;methanesulfonic acid |
| InChIKey | VSOYKBVTGHGMKC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1C2=CON=C2CN1 |
Computed by PubChem (NCBI)