Products 2228135-07-5

CAS 2228135-07-5 is the registry number for 4H,5H,6H-Pyrrolo(3,4-c)(1,2)oxazole, methanesulfonic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole;methanesulfonic acid (CAS 2228135-07-5) is a chemical compound with the molecular formula C6H10N2O4S and a molecular weight of 206.22 g/mol. IUPAC name: 5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole;methanesulfonic acid. InChIKey: VSOYKBVTGHGMKC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10N2O4S
Molecular weight206.22 g/mol
IUPAC name5,6-dihydro-4H-pyrrolo[3,4-c][1,2]oxazole;methanesulfonic acid
InChIKeyVSOYKBVTGHGMKC-UHFFFAOYSA-N
SMILESCS(=O)(=O)O.C1C2=CON=C2CN1

Computed by PubChem (NCBI)