Products 74710-09-1
CAS 74710-09-1 appears in our catalog under these names: 1,2-Phenylenediamine sulfate, 95%, 1，2–Phenylenediamine Sulfate, 1,2-Phenylenediamine Sulfate, >98.0%(T)(HPLC), Benzene-1,2-diamine sulfate, 95%, 95%, Benzene-1,2-diamine sulfate, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 500mg, 10g.
Benzene-1,2-diamine;sulfuric acid (CAS 74710-09-1) is a chemical compound with the molecular formula C6H10N2O4S and a molecular weight of 206.22 g/mol. IUPAC name: benzene-1,2-diamine;sulfuric acid. InChIKey: URGXGBOBXYFSAF-UHFFFAOYSA-N.
| Molecular formula | C6H10N2O4S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | benzene-1,2-diamine;sulfuric acid |
| InChIKey | URGXGBOBXYFSAF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)