Products 1609404-21-8

CAS 1609404-21-8 is the registry number for [(5-Ethyl-1,3,4-oxadiazol-2-yl)thio]acetic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid;hydrate (CAS 1609404-21-8) is a chemical compound with the molecular formula C6H10N2O4S and a molecular weight of 206.22 g/mol. IUPAC name: 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid;hydrate. InChIKey: IPFJSQHEHWAEKC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10N2O4S
Molecular weight206.22 g/mol
IUPAC name2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid;hydrate
InChIKeyIPFJSQHEHWAEKC-UHFFFAOYSA-N
SMILESCCC1=NN=C(O1)SCC(=O)O.O

Computed by PubChem (NCBI)