CAS 1146852-76-7 is the registry number for 1,3-Bis(methoxycarbonyl)-2-methyl-2-thiopseudourea, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
Methyl (NZ)-N-[(methoxycarbonylamino)-methylsulfanylmethylidene]carbamate (CAS 1146852-76-7) is a chemical compound with the molecular formula C6H10N2O4S and a molecular weight of 206.22 g/mol. IUPAC name: methyl (NZ)-N-[(methoxycarbonylamino)-methylsulfanylmethylidene]carbamate. InChIKey: KHBXLYPOXVQKJG-UHFFFAOYSA-N.
| Molecular formula | C6H10N2O4S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | methyl (NZ)-N-[(methoxycarbonylamino)-methylsulfanylmethylidene]carbamate |
| InChIKey | KHBXLYPOXVQKJG-UHFFFAOYSA-N |
| SMILES | COC(=O)N/C(=N/C(=O)OC)/SC |
Computed by PubChem (NCBI)