CAS 1008423-33-3 appears in our catalog under these names: 2–(2,6–Dichlorobenzenesulfonamido)–3–phenylpropanoic acid, 2-(2,6-Dichlorobenzenesulfonamido)-3-phenylpropanoic acid, 95%. Offered by: GLPBio, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 10g, 5g.
2-[(2,6-dichlorophenyl)sulfonylamino]-3-phenylpropanoic acid (CAS 1008423-33-3) is a chemical compound with the molecular formula C15H13Cl2NO4S and a molecular weight of 374.2 g/mol. IUPAC name: 2-[(2,6-dichlorophenyl)sulfonylamino]-3-phenylpropanoic acid. InChIKey: QNWDZDYRTQIGQP-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2NO4S |
|---|---|
| Molecular weight | 374.2 g/mol |
| IUPAC name | 2-[(2,6-dichlorophenyl)sulfonylamino]-3-phenylpropanoic acid |
| InChIKey | QNWDZDYRTQIGQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)NS(=O)(=O)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)