CAS 680618-29-5 appears in our catalog under these names: 3-(4-Chlorobenzamido)-4-ethoxybenzene-1-sulfonyl chloride, 97%, 3-(4-Chlorobenzoylamino)-4-ethoxybenzenesulfonyl chloride, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g.
3-[(4-chlorobenzoyl)amino]-4-ethoxybenzenesulfonyl chloride (CAS 680618-29-5) is a chemical compound with the molecular formula C15H13Cl2NO4S and a molecular weight of 374.2 g/mol. IUPAC name: 3-[(4-chlorobenzoyl)amino]-4-ethoxybenzenesulfonyl chloride. InChIKey: QGFMNHPMLUXXIA-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2NO4S |
|---|---|
| Molecular weight | 374.2 g/mol |
| IUPAC name | 3-[(4-chlorobenzoyl)amino]-4-ethoxybenzenesulfonyl chloride |
| InChIKey | QGFMNHPMLUXXIA-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)S(=O)(=O)Cl)NC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)