CAS 100844-07-3 appears in our catalog under these names: 2-(2,6-Diethylphenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 2-(2，6-Diethylphenyl)-1，3-dioxoisoindoline-5-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-(2,6-diethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 100844-07-3) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: 2-(2,6-diethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: GTYJWAXDSFDPFA-UHFFFAOYSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 2-(2,6-diethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | GTYJWAXDSFDPFA-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC=C1)CC)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)