Products 1008751-73-2

CAS 1008751-73-2 is the registry number for (2E)-6-(((1,1-Dimethylethoxy)carbonyl)amino)-2-hexenoic acid ethyl ester. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg, 500mg, 250mg.

Structural formula: {0} (CAS {1})

Ethyl (E)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoate (CAS 1008751-73-2) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: ethyl (E)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoate. InChIKey: HFZMXVYVTGGJRA-VQHVLOKHSA-N.

Identity
Molecular formulaC13H23NO4
Molecular weight257.33 g/mol
IUPAC nameethyl (E)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoate
InChIKeyHFZMXVYVTGGJRA-VQHVLOKHSA-N
SMILESCCOC(=O)/C=C/CCCNC(=O)OC(C)(C)C

Computed by PubChem (NCBI)