CAS 100891-10-9 appears in our catalog under these names: (E)-Methyl 3-(4-fluorophenyl)acrylate, 95+%, Methyl (E)–3–(4–fluorophenyl)acrylate, (E)-Methyl 3-(4-Fluorophenyl)Acrylate. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 0,25g, 2,5g.
Methyl (E)-3-(4-fluorophenyl)prop-2-enoate (CAS 100891-10-9) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: methyl (E)-3-(4-fluorophenyl)prop-2-enoate. InChIKey: HSNCAEKOZRUMTB-QPJJXVBHSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | methyl (E)-3-(4-fluorophenyl)prop-2-enoate |
| InChIKey | HSNCAEKOZRUMTB-QPJJXVBHSA-N |
| SMILES | COC(=O)/C=C/C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)