Products 100891-41-6
CAS 100891-41-6 is the registry number for Ro 14-9578. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-methyl-2-oxo-6,7-dihydro-[1,3]benzodioxolo[5,6-a]quinolizine-3-carboxylic acid (CAS 100891-41-6) is a chemical compound with the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. IUPAC name: 6-methyl-2-oxo-6,7-dihydro-[1,3]benzodioxolo[5,6-a]quinolizine-3-carboxylic acid. InChIKey: DJUJOTVZFFTBPC-UHFFFAOYSA-N.
| Molecular formula | C16H13NO5 |
|---|---|
| Molecular weight | 299.28 g/mol |
| IUPAC name | 6-methyl-2-oxo-6,7-dihydro-[1,3]benzodioxolo[5,6-a]quinolizine-3-carboxylic acid |
| InChIKey | DJUJOTVZFFTBPC-UHFFFAOYSA-N |
| SMILES | CC1CC2=CC3=C(C=C2C4=CC(=O)C(=CN14)C(=O)O)OCO3 |
Computed by PubChem (NCBI)