Products 175459-90-2
CAS 175459-90-2 appears in our catalog under these names: Ketorolac Impurity 59, Ketorolac Impurity 44. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-benzoyl-2,3-dihydropyrrolizine-1,1-dicarboxylic acid (CAS 175459-90-2) is a chemical compound with the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. IUPAC name: 5-benzoyl-2,3-dihydropyrrolizine-1,1-dicarboxylic acid. InChIKey: GBGSTRCSSBLPGI-UHFFFAOYSA-N.
| Molecular formula | C16H13NO5 |
|---|---|
| Molecular weight | 299.28 g/mol |
| IUPAC name | 5-benzoyl-2,3-dihydropyrrolizine-1,1-dicarboxylic acid |
| InChIKey | GBGSTRCSSBLPGI-UHFFFAOYSA-N |
| SMILES | C1CN2C(=CC=C2C1(C(=O)O)C(=O)O)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)