CAS 811841-53-9 appears in our catalog under these names: 2-(2-(N-Benzo[3,4-d]1,3-dioxolen-5-ylcarbamoyl)phenyl)acetic acid, 95%, 2-(2-(N-Benzo(3,4-d)1,3-dioxolen-5-ylcarbamoyl)phenyl)acetic acid, 2-[2-(Benzo[d][1,3]dioxol-5-ylcarbamoyl)phenyl]acetic acid, 98%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5000mg, 10g.
2-[2-(1,3-benzodioxol-5-ylcarbamoyl)phenyl]acetic acid (CAS 811841-53-9) is a chemical compound with the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. IUPAC name: 2-[2-(1,3-benzodioxol-5-ylcarbamoyl)phenyl]acetic acid. InChIKey: VCQBSKKJQUAQFI-UHFFFAOYSA-N.
| Molecular formula | C16H13NO5 |
|---|---|
| Molecular weight | 299.28 g/mol |
| IUPAC name | 2-[2-(1,3-benzodioxol-5-ylcarbamoyl)phenyl]acetic acid |
| InChIKey | VCQBSKKJQUAQFI-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC(=O)C3=CC=CC=C3CC(=O)O |
Computed by PubChem (NCBI)