CAS 309923-57-7 is the registry number for 4-[(2,3-Dihydro-1,4-benzodioxin-2-ylcarbonyl)amino]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
4-(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)benzoic acid (CAS 309923-57-7) is a chemical compound with the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. IUPAC name: 4-(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)benzoic acid. InChIKey: MUQLQGDBYNKRGW-UHFFFAOYSA-N.
| Molecular formula | C16H13NO5 |
|---|---|
| Molecular weight | 299.28 g/mol |
| IUPAC name | 4-(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)benzoic acid |
| InChIKey | MUQLQGDBYNKRGW-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2O1)C(=O)NC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)