CAS 477-78-1 is the registry number for Xanthevodine. Offered by: MedChemExpress. Available pack sizes: Get quote.
4,11-dimethoxy-5H-[1,3]dioxolo[4,5-b]acridin-10-one (CAS 477-78-1) is a chemical compound with the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. IUPAC name: 4,11-dimethoxy-5H-[1,3]dioxolo[4,5-b]acridin-10-one. InChIKey: XKWQECWFQVTROA-UHFFFAOYSA-N.
| Molecular formula | C16H13NO5 |
|---|---|
| Molecular weight | 299.28 g/mol |
| IUPAC name | 4,11-dimethoxy-5H-[1,3]dioxolo[4,5-b]acridin-10-one |
| InChIKey | XKWQECWFQVTROA-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C3=C1C(=O)C4=CC=CC=C4N3)OC)OCO2 |
Computed by PubChem (NCBI)