CAS 160777-11-7 is the registry number for 3-((5-(2-Nitrophenyl)furan-2-yl)methylene)pentane-2,4-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[[5-(2-nitrophenyl)furan-2-yl]methylidene]pentane-2,4-dione (CAS 160777-11-7) is a chemical compound with the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. IUPAC name: 3-[[5-(2-nitrophenyl)furan-2-yl]methylidene]pentane-2,4-dione. InChIKey: GLOWNPVOMSWLKX-UHFFFAOYSA-N.
| Molecular formula | C16H13NO5 |
|---|---|
| Molecular weight | 299.28 g/mol |
| IUPAC name | 3-[[5-(2-nitrophenyl)furan-2-yl]methylidene]pentane-2,4-dione |
| InChIKey | GLOWNPVOMSWLKX-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=CC1=CC=C(O1)C2=CC=CC=C2[N+](=O)[O-])C(=O)C |
Computed by PubChem (NCBI)