CAS 1009282-06-7 appears in our catalog under these names: 1-(2,3,5,6-Tetramethylphenylsulfonyl)-l-proline, 95%, 1–(2,3,5,6–Tetramethylphenyl)sulfonylpyrrolidine–2–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidine-2-carboxylic acid (CAS 1009282-06-7) is a chemical compound with the molecular formula C15H21NO4S and a molecular weight of 311.4 g/mol. IUPAC name: 1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidine-2-carboxylic acid. InChIKey: DFFZRBIPGBTBHG-UHFFFAOYSA-N.
| Molecular formula | C15H21NO4S |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidine-2-carboxylic acid |
| InChIKey | DFFZRBIPGBTBHG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)N2CCCC2C(=O)O)C)C |
Computed by PubChem (NCBI)