CAS 494838-94-7 appears in our catalog under these names: 3,4-Dimethyl-5-[(4-methylpiperidin-1-yl)sulfonyl]benzoic acid, 95%, 3,4-Dimethyl-5-((4-methylpiperidin-1-yl)sulfonyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3,4-dimethyl-5-(4-methylpiperidin-1-yl)sulfonylbenzoic acid (CAS 494838-94-7) is a chemical compound with the molecular formula C15H21NO4S and a molecular weight of 311.4 g/mol. IUPAC name: 3,4-dimethyl-5-(4-methylpiperidin-1-yl)sulfonylbenzoic acid. InChIKey: LETYSSRRWOHJQM-UHFFFAOYSA-N.
| Molecular formula | C15H21NO4S |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 3,4-dimethyl-5-(4-methylpiperidin-1-yl)sulfonylbenzoic acid |
| InChIKey | LETYSSRRWOHJQM-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)S(=O)(=O)C2=C(C(=CC(=C2)C(=O)O)C)C |
Computed by PubChem (NCBI)