CAS 623564-30-7 appears in our catalog under these names: 5-tert-Butyl 2-ethyl 6,7-dihydrothieno[3,2-c]pyridine-2,5(4h)-dicarboxylate, 95%, Ethyl 5-Boc-4,5,6,7-tetrahydrothieno(3,2-c)pyridine-2-carboxylate, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 10g.
5-O-tert-butyl 2-O-ethyl 6,7-dihydro-4H-thieno[3,2-c]pyridine-2,5-dicarboxylate (CAS 623564-30-7) is a chemical compound with the molecular formula C15H21NO4S and a molecular weight of 311.4 g/mol. IUPAC name: 5-O-tert-butyl 2-O-ethyl 6,7-dihydro-4H-thieno[3,2-c]pyridine-2,5-dicarboxylate. InChIKey: RNEKDGQEFWGWFA-UHFFFAOYSA-N.
| Molecular formula | C15H21NO4S |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 5-O-tert-butyl 2-O-ethyl 6,7-dihydro-4H-thieno[3,2-c]pyridine-2,5-dicarboxylate |
| InChIKey | RNEKDGQEFWGWFA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)