Products 349621-05-2
CAS 349621-05-2 appears in our catalog under these names: Ethyl 1-tosylpiperidine-3-carboxylate, 95%, Ethyl 1–Tosylpiperidine–3–Carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
Ethyl 1-(4-methylphenyl)sulfonylpiperidine-3-carboxylate (CAS 349621-05-2) is a chemical compound with the molecular formula C15H21NO4S and a molecular weight of 311.4 g/mol. IUPAC name: ethyl 1-(4-methylphenyl)sulfonylpiperidine-3-carboxylate. InChIKey: QWNLTOLQTVCPIC-UHFFFAOYSA-N.
| Molecular formula | C15H21NO4S |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | ethyl 1-(4-methylphenyl)sulfonylpiperidine-3-carboxylate |
| InChIKey | QWNLTOLQTVCPIC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCCN(C1)S(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)