Products 1217823-56-7
CAS 1217823-56-7 is the registry number for Boc-(s)-alpha-(2-thiophenylmethyl)-proline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid (CAS 1217823-56-7) is a chemical compound with the molecular formula C15H21NO4S and a molecular weight of 311.4 g/mol. IUPAC name: (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid. InChIKey: DDYQQTCCFAWKHK-HNNXBMFYSA-N.
| Molecular formula | C15H21NO4S |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid |
| InChIKey | DDYQQTCCFAWKHK-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@]1(CC2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)