CAS 394245-69-3 appears in our catalog under these names: 1-(Mesitylsulfonyl)piperidine-4-carboxylic acid, 95%, 1-(2,4,6-Trimethylbenzenesulfonyl)piperidine-4-carboxylic acid, 95%, 1-(2,4,6-Trimethylbenzenesulfonyl)piperidine-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxylic acid (CAS 394245-69-3) is a chemical compound with the molecular formula C15H21NO4S and a molecular weight of 311.4 g/mol. IUPAC name: 1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxylic acid. InChIKey: FATKZWGFYLEZOB-UHFFFAOYSA-N.
| Molecular formula | C15H21NO4S |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxylic acid |
| InChIKey | FATKZWGFYLEZOB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)N2CCC(CC2)C(=O)O)C |
Computed by PubChem (NCBI)