CAS 100988-28-1 is the registry number for 5-(2-Phenylethyl)-1,3-thiazol-2-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(2-phenylethyl)-1,3-thiazol-2-amine (CAS 100988-28-1) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 5-(2-phenylethyl)-1,3-thiazol-2-amine. InChIKey: FFDIQZFHXKHMES-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 5-(2-phenylethyl)-1,3-thiazol-2-amine |
| InChIKey | FFDIQZFHXKHMES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CN=C(S2)N |
Computed by PubChem (NCBI)