CAS 100991-92-2 appears in our catalog under these names: 1,4-Dideoxy-1,4-imino-D-arabinitol hydro, chloride, 10 mg, 1,4-Dideoxy-1,4-imino-D-arabinitol Hydrochloride, 1,4–dideoxy–1,4–imino–D–Arabinitol (hydrochloride), 1,4-DIDEOXY-1,4-IMINO-D-ARABINITOL HYD&, (2R,3R,4R)-3,4-Dihydroxy-2-(hydroxymethyl)pyrrolidine hydrochloride, ≥96%, ≥96%. Offered by: Roth, TRC, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 10mg, 1g, 1mg, 25mg, 5mg, 50mg, 250mg, 100mg.
(2R,3R,4R)-2-(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride (CAS 100991-92-2) is a chemical compound with the molecular formula C5H12ClNO3 and a molecular weight of 169.61 g/mol. IUPAC name: (2R,3R,4R)-2-(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride. InChIKey: PZGVJCJRMKIVLJ-DEVUXVJFSA-N.
| Molecular formula | C5H12ClNO3 |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | (2R,3R,4R)-2-(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride |
| InChIKey | PZGVJCJRMKIVLJ-DEVUXVJFSA-N |
| SMILES | C1[C@H]([C@@H]([C@H](N1)CO)O)O.Cl |
Computed by PubChem (NCBI)