CAS 186759-56-8 is the registry number for 1,4-Dideoxy-1,4-imino-D-xylitol HCl. Offered by: Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 25mg.
(2R,3S,4S)-2-(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride (CAS 186759-56-8) is a chemical compound with the molecular formula C5H12ClNO3 and a molecular weight of 169.61 g/mol. IUPAC name: (2R,3S,4S)-2-(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride. InChIKey: PZGVJCJRMKIVLJ-UZKLXKKNSA-N.
| Molecular formula | C5H12ClNO3 |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | (2R,3S,4S)-2-(hydroxymethyl)pyrrolidine-3,4-diol;hydrochloride |
| InChIKey | PZGVJCJRMKIVLJ-UZKLXKKNSA-N |
| SMILES | C1[C@@H]([C@H]([C@H](N1)CO)O)O.Cl |
Computed by PubChem (NCBI)