CAS 1010099-35-0 is the registry number for MI-2-80. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(benzylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 1010099-35-0) is a chemical compound with the molecular formula C20H17N3O4 and a molecular weight of 363.4 g/mol. IUPAC name: 5-(benzylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: MSGBAYDSSVGFRF-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O4 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 5-(benzylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | MSGBAYDSSVGFRF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)NCC4=CC=CC=C4 |
Computed by PubChem (NCBI)