CAS 1341762-24-0 is the registry number for 2-(4-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-1H-pyrazol-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)pyrazol-1-yl]acetic acid (CAS 1341762-24-0) is a chemical compound with the molecular formula C20H17N3O4 and a molecular weight of 363.4 g/mol. IUPAC name: 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)pyrazol-1-yl]acetic acid. InChIKey: FIAFUYXILFTVOZ-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O4 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)pyrazol-1-yl]acetic acid |
| InChIKey | FIAFUYXILFTVOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CN(N=C4)CC(=O)O |
Computed by PubChem (NCBI)