CAS 444287-56-3 appears in our catalog under these names: E3 ligase Ligand 23/ 98.49% (existing batch purity), E3 ligase Ligand 23, 4-(Benzylamino)-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione, 98%, 98%, E3 ligase Ligand 23, 98.39%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
4-(benzylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 444287-56-3) is a chemical compound with the molecular formula C20H17N3O4 and a molecular weight of 363.4 g/mol. IUPAC name: 4-(benzylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: JBYQCGLMICPOSQ-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O4 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 4-(benzylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | JBYQCGLMICPOSQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NCC4=CC=CC=C4 |
Computed by PubChem (NCBI)