Products 110392-56-8
CAS 110392-56-8 is the registry number for 4-Nitro-N-[(4-nitrophenyl)methyl]-N-phenylbenzenemethanamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N,N-bis[(4-nitrophenyl)methyl]aniline (CAS 110392-56-8) is a chemical compound with the molecular formula C20H17N3O4 and a molecular weight of 363.4 g/mol. IUPAC name: N,N-bis[(4-nitrophenyl)methyl]aniline. InChIKey: WGGCIWOSIIIJIB-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O4 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | N,N-bis[(4-nitrophenyl)methyl]aniline |
| InChIKey | WGGCIWOSIIIJIB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(CC2=CC=C(C=C2)[N+](=O)[O-])CC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)