Products 1609580-99-5
CAS 1609580-99-5 is the registry number for Noncatechol agonist-1. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg, 10 mg.
6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-1,5-dimethylpyrimidine-2,4-dione (CAS 1609580-99-5) is a chemical compound with the molecular formula C20H17N3O4 and a molecular weight of 363.4 g/mol. IUPAC name: 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-1,5-dimethylpyrimidine-2,4-dione. InChIKey: CKMFOKUQUOYIOR-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O4 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 6-(4-furo[3,2-c]pyridin-4-yloxy-2-methylphenyl)-1,5-dimethylpyrimidine-2,4-dione |
| InChIKey | CKMFOKUQUOYIOR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC2=NC=CC3=C2C=CO3)C4=C(C(=O)NC(=O)N4C)C |
Computed by PubChem (NCBI)
Synonyms:
orb3028098, VFP